C19H35NO7P2S — CID 15230147
4-(benzenesulfinyl)-N-[bis(diethoxyphosphoryl)methyl]butan-1-amine (PubChem CID 15230147) has the molecular formula C19H35NO7P2S and a molecular weight of 483.50 g/mol. Its IUPAC name is 4-(benzenesulfinyl)-N-[bis(diethoxyphosphoryl)methyl]butan-1-amine.
| Compound Name | 4-(benzenesulfinyl)-N-[bis(diethoxyphosphoryl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 15230147 |
| Molecular Formula | C19H35NO7P2S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-(benzenesulfinyl)-N-[bis(diethoxyphosphoryl)methyl]butan-1-amine |
| SMILES | CCOP(=O)(OCC)C(NCCCCS(=O)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H35NO7P2S/c1-5-24-28(21,25-6-2)19(29(22,26-7-3)27-8-4)20-16-12-13-17-30(23)18-14-10-9-11-15-18/h9-11,14-15,19-20H,5-8,12-13,16-17H2,1-4H3 |
| InChIKey | PBTXIXHMIPWPKC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|