C17H31NO6P2 — CID 5325126
1,1-bis(diethoxyphosphoryl)-N-[(4-methylphenyl)methyl]methanamine (PubChem CID 5325126) has the molecular formula C17H31NO6P2 and a molecular weight of 407.38 g/mol. Its IUPAC name is 1,1-bis(diethoxyphosphoryl)-N-[(4-methylphenyl)methyl]methanamine.
| Compound Name | 1,1-bis(diethoxyphosphoryl)-N-[(4-methylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 5325126 |
| Molecular Formula | C17H31NO6P2 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)-N-[(4-methylphenyl)methyl]methanamine |
| SMILES | CCOP(=O)(OCC)C(NCc1ccc(C)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H31NO6P2/c1-6-21-25(19,22-7-2)17(26(20,23-8-3)24-9-4)18-14-16-12-10-15(5)11-13-16/h10-13,17-18H,6-9,14H2,1-5H3 |
| InChIKey | UZXRBINLJGBZQR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|