C12H19O5PS — CID 90961878
diethoxyphosphoryl-(4-methylphenyl)methanesulfinic acid (PubChem CID 90961878) has the molecular formula C12H19O5PS and a molecular weight of 306.32 g/mol. Its IUPAC name is diethoxyphosphoryl-(4-methylphenyl)methanesulfinic acid.
| Compound Name | diethoxyphosphoryl-(4-methylphenyl)methanesulfinic acid |
|---|---|
| PubChem CID | 90961878 |
| Molecular Formula | C12H19O5PS |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | diethoxyphosphoryl-(4-methylphenyl)methanesulfinic acid |
| SMILES | CCOP(=O)(OCC)C(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C12H19O5PS/c1-4-16-18(13,17-5-2)12(19(14)15)11-8-6-10(3)7-9-11/h6-9,12H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | VTMYLWYJUDRGTM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|