C18H30Cl2O6PSb — CID 23412708
bis(2-chloropropyl) [diethoxyphosphoryl-(4-methylphenyl)methyl] stiborite (PubChem CID 23412708) has the molecular formula C18H30Cl2O6PSb and a molecular weight of 566.07 g/mol. Its IUPAC name is bis(2-chloropropyl) [diethoxyphosphoryl-(4-methylphenyl)methyl] stiborite.
| Compound Name | bis(2-chloropropyl) [diethoxyphosphoryl-(4-methylphenyl)methyl] stiborite |
|---|---|
| PubChem CID | 23412708 |
| Molecular Formula | C18H30Cl2O6PSb |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | bis(2-chloropropyl) [diethoxyphosphoryl-(4-methylphenyl)methyl] stiborite |
| SMILES | CCOP(=O)(OCC)C(O[Sb](OCC(C)Cl)OCC(C)Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H18O4P.2C3H6ClO.Sb/c1-4-15-17(14,16-5-2)12(13)11-8-6-10(3)7-9-11;2*1-3(4)2-5;/h6-9,12H,4-5H2,1-3H3;2*3H,2H2,1H3;/q3*-1;+3 |
| InChIKey | JPPTUWNJPFCHEM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|