About 1-(4-methylphenyl)propyl hydrogen sulfite
1-(4-methylphenyl)propyl hydrogen sulfite (PubChem CID 175051179) has the molecular formula C10H14O3S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-(4-methylphenyl)propyl hydrogen sulfite.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)propyl hydrogen sulfite |
| PubChem CID | 175051179 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(4-methylphenyl)propyl hydrogen sulfite |
| SMILES | CCC(OS(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H14O3S/c1-3-10(13-14(11)12)9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3,(H,11,12) |
| InChIKey | XALGOPXDTXMZGX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)propyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)propyl hydrogen sulfite?
The IUPAC name of 1-(4-methylphenyl)propyl hydrogen sulfite (CID 175051179) is 1-(4-methylphenyl)propyl hydrogen sulfite.
What is the SMILES notation for 1-(4-methylphenyl)propyl hydrogen sulfite?
The canonical SMILES for 1-(4-methylphenyl)propyl hydrogen sulfite is CCC(OS(=O)O)c1ccc(C)cc1.
What is the InChIKey of 1-(4-methylphenyl)propyl hydrogen sulfite?
The InChIKey is XALGOPXDTXMZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3S/c1-3-10(13-14(11)12)9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3,(H,11,12).
What are the key properties of 1-(4-methylphenyl)propyl hydrogen sulfite?
1-(4-methylphenyl)propyl hydrogen sulfite has a molecular weight of 214.29 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)propyl hydrogen sulfite is sourced from PubChem (CID 175051179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).