About (3-amino-1-phenylbutyl) hydrogen sulfite
(3-amino-1-phenylbutyl) hydrogen sulfite (PubChem CID 174541474) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is (3-amino-1-phenylbutyl) hydrogen sulfite.
Molecular Properties
| Compound Name | (3-amino-1-phenylbutyl) hydrogen sulfite |
| PubChem CID | 174541474 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | (3-amino-1-phenylbutyl) hydrogen sulfite |
| SMILES | CC(N)CC(OS(=O)O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO3S/c1-8(11)7-10(14-15(12)13)9-5-3-2-4-6-9/h2-6,8,10H,7,11H2,1H3,(H,12,13) |
| InChIKey | CTWWBSVMWOVCMR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-1-phenylbutyl) hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-1-phenylbutyl) hydrogen sulfite?
The IUPAC name of (3-amino-1-phenylbutyl) hydrogen sulfite (CID 174541474) is (3-amino-1-phenylbutyl) hydrogen sulfite.
What is the SMILES notation for (3-amino-1-phenylbutyl) hydrogen sulfite?
The canonical SMILES for (3-amino-1-phenylbutyl) hydrogen sulfite is CC(N)CC(OS(=O)O)c1ccccc1.
What is the InChIKey of (3-amino-1-phenylbutyl) hydrogen sulfite?
The InChIKey is CTWWBSVMWOVCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-8(11)7-10(14-15(12)13)9-5-3-2-4-6-9/h2-6,8,10H,7,11H2,1H3,(H,12,13).
What are the key properties of (3-amino-1-phenylbutyl) hydrogen sulfite?
(3-amino-1-phenylbutyl) hydrogen sulfite has a molecular weight of 229.30 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-1-phenylbutyl) hydrogen sulfite is sourced from PubChem (CID 174541474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).