About 1-(benzylamino)ethyl hydrogen sulfite
1-(benzylamino)ethyl hydrogen sulfite (PubChem CID 57130013) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 1-(benzylamino)ethyl hydrogen sulfite.
Molecular Properties
| Compound Name | 1-(benzylamino)ethyl hydrogen sulfite |
| PubChem CID | 57130013 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-(benzylamino)ethyl hydrogen sulfite |
| SMILES | CC(NCc1ccccc1)OS(=O)O |
| InChI | InChI=1S/C9H13NO3S/c1-8(13-14(11)12)10-7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,11,12) |
| InChIKey | PWVNWHXZPSLCKI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzylamino)ethyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzylamino)ethyl hydrogen sulfite?
The IUPAC name of 1-(benzylamino)ethyl hydrogen sulfite (CID 57130013) is 1-(benzylamino)ethyl hydrogen sulfite.
What is the SMILES notation for 1-(benzylamino)ethyl hydrogen sulfite?
The canonical SMILES for 1-(benzylamino)ethyl hydrogen sulfite is CC(NCc1ccccc1)OS(=O)O.
What is the InChIKey of 1-(benzylamino)ethyl hydrogen sulfite?
The InChIKey is PWVNWHXZPSLCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-8(13-14(11)12)10-7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,11,12).
What are the key properties of 1-(benzylamino)ethyl hydrogen sulfite?
1-(benzylamino)ethyl hydrogen sulfite has a molecular weight of 215.27 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzylamino)ethyl hydrogen sulfite is sourced from PubChem (CID 57130013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).