C11H11F3O5S — CID 174287158
4-phenyl-4-sulfinooxy-2-(trifluoromethyl)butanoic acid (PubChem CID 174287158) has the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. Its IUPAC name is 4-phenyl-4-sulfinooxy-2-(trifluoromethyl)butanoic acid.
| Compound Name | 4-phenyl-4-sulfinooxy-2-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 174287158 |
| Molecular Formula | C11H11F3O5S |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-phenyl-4-sulfinooxy-2-(trifluoromethyl)butanoic acid |
| SMILES | O=C(O)C(CC(OS(=O)O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O5S/c12-11(13,14)8(10(15)16)6-9(19-20(17)18)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,15,16)(H,17,18) |
| InChIKey | OOYHDPVBAXWLDY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|