C8H7F3O2S — CID 18758760
2,2,2-trifluoro-1-phenylethanesulfinic acid (PubChem CID 18758760) has the molecular formula C8H7F3O2S and a molecular weight of 224.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-phenylethanesulfinic acid.
| Compound Name | 2,2,2-trifluoro-1-phenylethanesulfinic acid |
|---|---|
| PubChem CID | 18758760 |
| Molecular Formula | C8H7F3O2S |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2,2,2-trifluoro-1-phenylethanesulfinic acid |
| SMILES | O=S(O)C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H7F3O2S/c9-8(10,11)7(14(12)13)6-4-2-1-3-5-6/h1-5,7H,(H,12,13) |
| InChIKey | MEZNYAKYIYRCJQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|