C9H11F3N2O4S2 — CID 70951176
[(1R)-2-(sulfinoamino)-1-(trifluoromethylsulfonylamino)ethyl]benzene (PubChem CID 70951176) has the molecular formula C9H11F3N2O4S2 and a molecular weight of 332.33 g/mol. Its IUPAC name is [(1R)-2-(sulfinoamino)-1-(trifluoromethylsulfonylamino)ethyl]benzene.
| Compound Name | [(1R)-2-(sulfinoamino)-1-(trifluoromethylsulfonylamino)ethyl]benzene |
|---|---|
| PubChem CID | 70951176 |
| Molecular Formula | C9H11F3N2O4S2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | [(1R)-2-(sulfinoamino)-1-(trifluoromethylsulfonylamino)ethyl]benzene |
| SMILES | O=S(O)NC[C@H](NS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H11F3N2O4S2/c10-9(11,12)20(17,18)14-8(6-13-19(15)16)7-4-2-1-3-5-7/h1-5,8,13-14H,6H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | SIKPKUMPDMSNTQ-QMMMGPOBSA-N |
| XLogP | 0.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|