C11H11F4NO4S — CID 166446318
methyl (3S)-3-(4-fluorophenyl)-3-(trifluoromethylsulfonylamino)propanoate (PubChem CID 166446318) has the molecular formula C11H11F4NO4S and a molecular weight of 329.27 g/mol. Its IUPAC name is methyl (3S)-3-(4-fluorophenyl)-3-(trifluoromethylsulfonylamino)propanoate.
| Compound Name | methyl (3S)-3-(4-fluorophenyl)-3-(trifluoromethylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 166446318 |
| Molecular Formula | C11H11F4NO4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | methyl (3S)-3-(4-fluorophenyl)-3-(trifluoromethylsulfonylamino)propanoate |
| SMILES | COC(=O)C[C@H](NS(=O)(=O)C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11F4NO4S/c1-20-10(17)6-9(7-2-4-8(12)5-3-7)16-21(18,19)11(13,14)15/h2-5,9,16H,6H2,1H3/t9-/m0/s1 |
| InChIKey | FDMVXXKILPPCKX-VIFPVBQESA-N |
| XLogP | 1.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |