C16H13F4NO4S — CID 94651707
methyl (3R)-3-(4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)sulfonylamino]propanoate (PubChem CID 94651707) has the molecular formula C16H13F4NO4S and a molecular weight of 391.34 g/mol. Its IUPAC name is methyl (3R)-3-(4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (3R)-3-(4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 94651707 |
| Molecular Formula | C16H13F4NO4S |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | methyl (3R)-3-(4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C[C@@H](NS(=O)(=O)c1ccc(F)c(F)c1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13F4NO4S/c1-25-14(22)8-12(9-2-4-10(17)5-3-9)21-26(23,24)13-7-6-11(18)15(19)16(13)20/h2-7,12,21H,8H2,1H3/t12-/m1/s1 |
| InChIKey | CEBVIHKIIZLCQF-GFCCVEGCSA-N |
| XLogP | 2.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|