C21H25FN2O6S — CID 55995317
methyl 3-(4-fluorophenyl)-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate (PubChem CID 55995317) has the molecular formula C21H25FN2O6S and a molecular weight of 452.50 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate.
| Compound Name | methyl 3-(4-fluorophenyl)-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 55995317 |
| Molecular Formula | C21H25FN2O6S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(OC)c(S(=O)(=O)NC(C)C)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O6S/c1-13(2)24-31(27,28)19-11-15(7-10-18(19)29-3)21(26)23-17(12-20(25)30-4)14-5-8-16(22)9-6-14/h5-11,13,17,24H,12H2,1-4H3,(H,23,26) |
| InChIKey | JFSOKNUGMRQCAN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |