C19H21BrN2O6S — CID 52908538
methyl (3R)-3-(3-bromophenyl)-3-[[4-methoxy-3-(methylsulfamoyl)benzoyl]amino]propanoate (PubChem CID 52908538) has the molecular formula C19H21BrN2O6S and a molecular weight of 485.36 g/mol. Its IUPAC name is methyl (3R)-3-(3-bromophenyl)-3-[[4-methoxy-3-(methylsulfamoyl)benzoyl]amino]propanoate.
| Compound Name | methyl (3R)-3-(3-bromophenyl)-3-[[4-methoxy-3-(methylsulfamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 52908538 |
| Molecular Formula | C19H21BrN2O6S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | methyl (3R)-3-(3-bromophenyl)-3-[[4-methoxy-3-(methylsulfamoyl)benzoyl]amino]propanoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N[C@H](CC(=O)OC)c2cccc(Br)c2)ccc1OC |
| InChI | InChI=1S/C19H21BrN2O6S/c1-21-29(25,26)17-10-13(7-8-16(17)27-2)19(24)22-15(11-18(23)28-3)12-5-4-6-14(20)9-12/h4-10,15,21H,11H2,1-3H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | GAXMYWIUKDGSHS-OAHLLOKOSA-N |
| XLogP | 2.40 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |