C9H7BrF3NO3S — CID 154221934
N-(1-bromo-2-oxo-2-phenylethyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 154221934) has the molecular formula C9H7BrF3NO3S and a molecular weight of 346.12 g/mol. Its IUPAC name is N-(1-bromo-2-oxo-2-phenylethyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(1-bromo-2-oxo-2-phenylethyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 154221934 |
| Molecular Formula | C9H7BrF3NO3S |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | N-(1-bromo-2-oxo-2-phenylethyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=C(c1ccccc1)C(Br)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7BrF3NO3S/c10-8(14-18(16,17)9(11,12)13)7(15)6-4-2-1-3-5-6/h1-5,8,14H |
| InChIKey | DPUBRIQMQOKQIJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|