C18H16Br2O2 — CID 2762432
2,5-dibromo-1,6-diphenylhexane-1,6-dione (PubChem CID 2762432) has the molecular formula C18H16Br2O2 and a molecular weight of 424.13 g/mol. Its IUPAC name is 2,5-dibromo-1,6-diphenylhexane-1,6-dione.
| Compound Name | 2,5-dibromo-1,6-diphenylhexane-1,6-dione |
|---|---|
| PubChem CID | 2762432 |
| Molecular Formula | C18H16Br2O2 |
| Molecular Weight | 424.13 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 2,5-dibromo-1,6-diphenylhexane-1,6-dione |
| SMILES | O=C(c1ccccc1)C(Br)CCC(Br)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16Br2O2/c19-15(17(21)13-7-3-1-4-8-13)11-12-16(20)18(22)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | CYMCSOQEVOCQBZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.13 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|