C10H7BrO4 — CID 142761729
3-bromo-2,4-dioxo-4-phenylbutanoic acid (PubChem CID 142761729) has the molecular formula C10H7BrO4 and a molecular weight of 271.07 g/mol. Its IUPAC name is 3-bromo-2,4-dioxo-4-phenylbutanoic acid.
| Compound Name | 3-bromo-2,4-dioxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 142761729 |
| Molecular Formula | C10H7BrO4 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 3-bromo-2,4-dioxo-4-phenylbutanoic acid |
| SMILES | O=C(O)C(=O)C(Br)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H7BrO4/c11-7(9(13)10(14)15)8(12)6-4-2-1-3-5-6/h1-5,7H,(H,14,15) |
| InChIKey | NWZGGIIBJNBDDP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|