3-bromo-2,4-dioxo-4-phenylbutanoic acid

C10H7BrO4 — CID 142761729

IUPAC3-bromo-2,4-dioxo-4-phenylbutanoic acid
SMILESO=C(O)C(=O)C(Br)C(=O)c1ccccc1
InChIInChI=1S/C10H7BrO4/c11-7(9(13)10(14)15)8(12)6-4-2-1-3-5-6/h1-5,7H,(H,14,15)
InChIKeyNWZGGIIBJNBDDP-UHFFFAOYSA-N
MW271.07 g/mol
LogP1.29
Rot. Bonds4

About 3-bromo-2,4-dioxo-4-phenylbutanoic acid

3-bromo-2,4-dioxo-4-phenylbutanoic acid (PubChem CID 142761729) has the molecular formula C10H7BrO4 and a molecular weight of 271.07 g/mol. Its IUPAC name is 3-bromo-2,4-dioxo-4-phenylbutanoic acid.

Molecular Properties

Compound Name3-bromo-2,4-dioxo-4-phenylbutanoic acid
PubChem CID142761729
Molecular FormulaC10H7BrO4
Molecular Weight271.07 g/mol
Exact Mass269.95
IUPAC Name3-bromo-2,4-dioxo-4-phenylbutanoic acid
SMILESO=C(O)C(=O)C(Br)C(=O)c1ccccc1
InChIInChI=1S/C10H7BrO4/c11-7(9(13)10(14)15)8(12)6-4-2-1-3-5-6/h1-5,7H,(H,14,15)
InChIKeyNWZGGIIBJNBDDP-UHFFFAOYSA-N
XLogP1.29
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.07
LogP ≤ 51.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 3-bromo-2,4-dioxo-4-phenylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-2,4-dioxo-4-phenylbutanoic acid?
The IUPAC name of 3-bromo-2,4-dioxo-4-phenylbutanoic acid (CID 142761729) is 3-bromo-2,4-dioxo-4-phenylbutanoic acid.
What is the SMILES notation for 3-bromo-2,4-dioxo-4-phenylbutanoic acid?
The canonical SMILES for 3-bromo-2,4-dioxo-4-phenylbutanoic acid is O=C(O)C(=O)C(Br)C(=O)c1ccccc1.
What is the InChIKey of 3-bromo-2,4-dioxo-4-phenylbutanoic acid?
The InChIKey is NWZGGIIBJNBDDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO4/c11-7(9(13)10(14)15)8(12)6-4-2-1-3-5-6/h1-5,7H,(H,14,15).
What are the key properties of 3-bromo-2,4-dioxo-4-phenylbutanoic acid?
3-bromo-2,4-dioxo-4-phenylbutanoic acid has a molecular weight of 271.07 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-dioxo-4-phenylbutanoic acid is sourced from PubChem (CID 142761729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).