C18H26BrNO2 — CID 129383719
(3S)-3-bromo-N,N-dibutyl-4-oxo-4-phenylbutanamide (PubChem CID 129383719) has the molecular formula C18H26BrNO2 and a molecular weight of 368.31 g/mol. Its IUPAC name is (3S)-3-bromo-N,N-dibutyl-4-oxo-4-phenylbutanamide.
| Compound Name | (3S)-3-bromo-N,N-dibutyl-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 129383719 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (3S)-3-bromo-N,N-dibutyl-4-oxo-4-phenylbutanamide |
| SMILES | CCCCN(CCCC)C(=O)C[C@H](Br)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26BrNO2/c1-3-5-12-20(13-6-4-2)17(21)14-16(19)18(22)15-10-8-7-9-11-15/h7-11,16H,3-6,12-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | VPLZYYCBJOGENK-INIZCTEOSA-N |
| XLogP | 4.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|