C18H27NO2 — CID 10684868
N,N-dibutyl-4-oxo-4-phenylbutanamide (PubChem CID 10684868) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N,N-dibutyl-4-oxo-4-phenylbutanamide.
| Compound Name | N,N-dibutyl-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 10684868 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N,N-dibutyl-4-oxo-4-phenylbutanamide |
| SMILES | CCCCN(CCCC)C(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-3-5-14-19(15-6-4-2)18(21)13-12-17(20)16-10-8-7-9-11-16/h7-11H,3-6,12-15H2,1-2H3 |
| InChIKey | HAESHOATZSYEQE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |