benzoic acid;dibutylcarbamic acid

C16H25NO4 — CID 160812669

IUPACbenzoic acid;dibutylcarbamic acid
SMILESCCCCN(CCCC)C(=O)O.O=C(O)c1ccccc1
InChIInChI=1S/C9H19NO2.C7H6O2/c1-3-5-7-10(9(11)12)8-6-4-2;8-7(9)6-4-2-1-3-5-6/h3-8H2,1-2H3,(H,11,12);1-5H,(H,8,9)
InChIKeySEMSAGFXDMCMRQ-UHFFFAOYSA-N
MW295.38 g/mol
LogP3.95
Rot. Bonds7

About benzoic acid;dibutylcarbamic acid

benzoic acid;dibutylcarbamic acid (PubChem CID 160812669) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is benzoic acid;dibutylcarbamic acid.

Molecular Properties

Compound Namebenzoic acid;dibutylcarbamic acid
PubChem CID160812669
Molecular FormulaC16H25NO4
Molecular Weight295.38 g/mol
Exact Mass295.18
IUPAC Namebenzoic acid;dibutylcarbamic acid
SMILESCCCCN(CCCC)C(=O)O.O=C(O)c1ccccc1
InChIInChI=1S/C9H19NO2.C7H6O2/c1-3-5-7-10(9(11)12)8-6-4-2;8-7(9)6-4-2-1-3-5-6/h3-8H2,1-2H3,(H,11,12);1-5H,(H,8,9)
InChIKeySEMSAGFXDMCMRQ-UHFFFAOYSA-N
XLogP3.95
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.38
LogP ≤ 53.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze benzoic acid;dibutylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzoic acid;dibutylcarbamic acid?
The IUPAC name of benzoic acid;dibutylcarbamic acid (CID 160812669) is benzoic acid;dibutylcarbamic acid.
What is the SMILES notation for benzoic acid;dibutylcarbamic acid?
The canonical SMILES for benzoic acid;dibutylcarbamic acid is CCCCN(CCCC)C(=O)O.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;dibutylcarbamic acid?
The InChIKey is SEMSAGFXDMCMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.C7H6O2/c1-3-5-7-10(9(11)12)8-6-4-2;8-7(9)6-4-2-1-3-5-6/h3-8H2,1-2H3,(H,11,12);1-5H,(H,8,9).
What are the key properties of benzoic acid;dibutylcarbamic acid?
benzoic acid;dibutylcarbamic acid has a molecular weight of 295.38 g/mol, XLogP of 3.95, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;dibutylcarbamic acid is sourced from PubChem (CID 160812669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).