About benzoic acid;dibutylcarbamic acid
benzoic acid;dibutylcarbamic acid (PubChem CID 160812669) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is benzoic acid;dibutylcarbamic acid.
Molecular Properties
| Compound Name | benzoic acid;dibutylcarbamic acid |
| PubChem CID | 160812669 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | benzoic acid;dibutylcarbamic acid |
| SMILES | CCCCN(CCCC)C(=O)O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H19NO2.C7H6O2/c1-3-5-7-10(9(11)12)8-6-4-2;8-7(9)6-4-2-1-3-5-6/h3-8H2,1-2H3,(H,11,12);1-5H,(H,8,9) |
| InChIKey | SEMSAGFXDMCMRQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoic acid;dibutylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;dibutylcarbamic acid?
The IUPAC name of benzoic acid;dibutylcarbamic acid (CID 160812669) is benzoic acid;dibutylcarbamic acid.
What is the SMILES notation for benzoic acid;dibutylcarbamic acid?
The canonical SMILES for benzoic acid;dibutylcarbamic acid is CCCCN(CCCC)C(=O)O.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;dibutylcarbamic acid?
The InChIKey is SEMSAGFXDMCMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.C7H6O2/c1-3-5-7-10(9(11)12)8-6-4-2;8-7(9)6-4-2-1-3-5-6/h3-8H2,1-2H3,(H,11,12);1-5H,(H,8,9).
What are the key properties of benzoic acid;dibutylcarbamic acid?
benzoic acid;dibutylcarbamic acid has a molecular weight of 295.38 g/mol, XLogP of 3.95, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;dibutylcarbamic acid is sourced from PubChem (CID 160812669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).