C16H25NO4 — CID 160812669
benzoic acid;dibutylcarbamic acid (PubChem CID 160812669) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is benzoic acid;dibutylcarbamic acid.
| Compound Name | benzoic acid;dibutylcarbamic acid |
|---|---|
| PubChem CID | 160812669 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | benzoic acid;dibutylcarbamic acid |
| SMILES | CCCCN(CCCC)C(=O)O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H19NO2.C7H6O2/c1-3-5-7-10(9(11)12)8-6-4-2;8-7(9)6-4-2-1-3-5-6/h3-8H2,1-2H3,(H,11,12);1-5H,(H,8,9) |
| InChIKey | SEMSAGFXDMCMRQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |