C14H19NO2 — CID 10399096
N,N-diethyl-4-oxo-4-phenylbutanamide (PubChem CID 10399096) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N,N-diethyl-4-oxo-4-phenylbutanamide.
| Compound Name | N,N-diethyl-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 10399096 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N,N-diethyl-4-oxo-4-phenylbutanamide |
| SMILES | CCN(CC)C(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-3-15(4-2)14(17)11-10-13(16)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | FDJMRMWUJXYPMB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |