C18H25BrFNO2 — CID 25067893
3-bromo-N,N-dibutyl-4-(4-fluorophenyl)-4-oxobutanamide (PubChem CID 25067893) has the molecular formula C18H25BrFNO2 and a molecular weight of 386.31 g/mol. Its IUPAC name is 3-bromo-N,N-dibutyl-4-(4-fluorophenyl)-4-oxobutanamide.
| Compound Name | 3-bromo-N,N-dibutyl-4-(4-fluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 25067893 |
| Molecular Formula | C18H25BrFNO2 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-bromo-N,N-dibutyl-4-(4-fluorophenyl)-4-oxobutanamide |
| SMILES | CCCCN(CCCC)C(=O)CC(Br)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H25BrFNO2/c1-3-5-11-21(12-6-4-2)17(22)13-16(19)18(23)14-7-9-15(20)10-8-14/h7-10,16H,3-6,11-13H2,1-2H3 |
| InChIKey | PWKYNOGCHIXGLD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|