C22H35NO3 — CID 164677097
(1-oxo-1-phenylpropan-2-yl) N,N-dihexylcarbamate (PubChem CID 164677097) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) N,N-dihexylcarbamate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) N,N-dihexylcarbamate |
|---|---|
| PubChem CID | 164677097 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OC(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H35NO3/c1-4-6-8-13-17-23(18-14-9-7-5-2)22(25)26-19(3)21(24)20-15-11-10-12-16-20/h10-12,15-16,19H,4-9,13-14,17-18H2,1-3H3 |
| InChIKey | RYDSKMGPHQXQBT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|