About 1-phenylpropyl 4-methylbenzenesulfinate
1-phenylpropyl 4-methylbenzenesulfinate (PubChem CID 75274763) has the molecular formula C16H18O2S
and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-phenylpropyl 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | 1-phenylpropyl 4-methylbenzenesulfinate |
| PubChem CID | 75274763 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-phenylpropyl 4-methylbenzenesulfinate |
| SMILES | CCC(OS(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H18O2S/c1-3-16(14-7-5-4-6-8-14)18-19(17)15-11-9-13(2)10-12-15/h4-12,16H,3H2,1-2H3 |
| InChIKey | OKHZBHKGZWXRAT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropyl 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropyl 4-methylbenzenesulfinate?
The IUPAC name of 1-phenylpropyl 4-methylbenzenesulfinate (CID 75274763) is 1-phenylpropyl 4-methylbenzenesulfinate.
What is the SMILES notation for 1-phenylpropyl 4-methylbenzenesulfinate?
The canonical SMILES for 1-phenylpropyl 4-methylbenzenesulfinate is CCC(OS(=O)c1ccc(C)cc1)c1ccccc1.
What is the InChIKey of 1-phenylpropyl 4-methylbenzenesulfinate?
The InChIKey is OKHZBHKGZWXRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2S/c1-3-16(14-7-5-4-6-8-14)18-19(17)15-11-9-13(2)10-12-15/h4-12,16H,3H2,1-2H3.
What are the key properties of 1-phenylpropyl 4-methylbenzenesulfinate?
1-phenylpropyl 4-methylbenzenesulfinate has a molecular weight of 274.39 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropyl 4-methylbenzenesulfinate is sourced from PubChem (CID 75274763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).