C31H34O2SSi — CID 134878629
tert-butyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]-diphenylsilane (PubChem CID 134878629) has the molecular formula C31H34O2SSi and a molecular weight of 498.76 g/mol. Its IUPAC name is tert-butyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134878629 |
| Molecular Formula | C31H34O2SSi |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | tert-butyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34O2SSi/c1-25-20-22-27(23-21-25)34(32)24-30(26-14-8-5-9-15-26)33-35(31(2,3)4,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-23,30H,24H2,1-4H3 |
| InChIKey | UKVBZCWCBRLTOO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|