C23H33BrO3SSi — CID 11352483
(1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutan-1-ol (PubChem CID 11352483) has the molecular formula C23H33BrO3SSi and a molecular weight of 497.57 g/mol. Its IUPAC name is (1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutan-1-ol.
| Compound Name | (1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 11352483 |
| Molecular Formula | C23H33BrO3SSi |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutan-1-ol |
| SMILES | Cc1ccc([S@@](=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Br)[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H33BrO3SSi/c1-17-12-14-19(15-13-17)28(26)16-20(27-29(5,6)23(2,3)4)21(24)22(25)18-10-8-7-9-11-18/h7-15,20-22,25H,16H2,1-6H3/t20-,21-,22+,28-/m0/s1 |
| InChIKey | NNDIIPKCTBKABI-WENLUUPESA-N |
| XLogP | 5.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|