C25H36BrNO4SSi — CID 11341897
[(1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutyl] N-methylcarbamate (PubChem CID 11341897) has the molecular formula C25H36BrNO4SSi and a molecular weight of 554.62 g/mol. Its IUPAC name is [(1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutyl] N-methylcarbamate.
| Compound Name | [(1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutyl] N-methylcarbamate |
|---|---|
| PubChem CID | 11341897 |
| Molecular Formula | C25H36BrNO4SSi |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | [(1R,2R,3S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylbutyl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@H](c1ccccc1)[C@@H](Br)[C@H](C[S@](=O)c1ccc(C)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H36BrNO4SSi/c1-18-13-15-20(16-14-18)32(29)17-21(31-33(6,7)25(2,3)4)22(26)23(30-24(28)27-5)19-11-9-8-10-12-19/h8-16,21-23H,17H2,1-7H3,(H,27,28)/t21-,22-,23+,32-/m0/s1 |
| InChIKey | VSLGALZMFXVRCG-XIVFLLIASA-N |
| XLogP | 6.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|