C27H40O5S2Si — CID 10840087
[(E,1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-[(S)-(4-methylphenyl)sulfinyl]-1-phenylhex-3-en-2-yl] methanesulfonate (PubChem CID 10840087) has the molecular formula C27H40O5S2Si and a molecular weight of 536.83 g/mol. Its IUPAC name is [(E,1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-[(S)-(4-methylphenyl)sulfinyl]-1-phenylhex-3-en-2-yl] methanesulfonate.
| Compound Name | [(E,1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-[(S)-(4-methylphenyl)sulfinyl]-1-phenylhex-3-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 10840087 |
| Molecular Formula | C27H40O5S2Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | [(E,1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-[(S)-(4-methylphenyl)sulfinyl]-1-phenylhex-3-en-2-yl] methanesulfonate |
| SMILES | Cc1ccc([S@](=O)/C(=C/C(C)C)[C@@H](OS(C)(=O)=O)[C@@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H40O5S2Si/c1-20(2)19-24(33(28)23-17-15-21(3)16-18-23)26(31-34(7,29)30)25(22-13-11-10-12-14-22)32-35(8,9)27(4,5)6/h10-20,25-26H,1-9H3/b24-19+/t25-,26+,33-/m0/s1 |
| InChIKey | PVXOGYACZWIYDE-KRQWJSBWSA-N |
| XLogP | 6.75 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|