C24H26O7S — CID 11294078
[(E,5R)-2,5-diacetyloxy-4-[(S)-(4-methylphenyl)sulfinyl]-5-phenylpent-3-enyl] acetate (PubChem CID 11294078) has the molecular formula C24H26O7S and a molecular weight of 458.53 g/mol. Its IUPAC name is [(E,5R)-2,5-diacetyloxy-4-[(S)-(4-methylphenyl)sulfinyl]-5-phenylpent-3-enyl] acetate.
| Compound Name | [(E,5R)-2,5-diacetyloxy-4-[(S)-(4-methylphenyl)sulfinyl]-5-phenylpent-3-enyl] acetate |
|---|---|
| PubChem CID | 11294078 |
| Molecular Formula | C24H26O7S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(E,5R)-2,5-diacetyloxy-4-[(S)-(4-methylphenyl)sulfinyl]-5-phenylpent-3-enyl] acetate |
| SMILES | CC(=O)OCC(/C=C(\[C@H](OC(C)=O)c1ccccc1)[S@@](=O)c1ccc(C)cc1)OC(C)=O |
| InChI | InChI=1S/C24H26O7S/c1-16-10-12-22(13-11-16)32(28)23(14-21(30-18(3)26)15-29-17(2)25)24(31-19(4)27)20-8-6-5-7-9-20/h5-14,21,24H,15H2,1-4H3/b23-14+/t21?,24-,32+/m1/s1 |
| InChIKey | AILKPHNJSNWQOJ-LTBVWIHNSA-N |
| XLogP | 3.79 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|