C20H24O2S — CID 101210456
(Z,1S)-2-(4-methylphenyl)sulfinyl-1-phenylhept-2-en-1-ol (PubChem CID 101210456) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is (Z,1S)-2-(4-methylphenyl)sulfinyl-1-phenylhept-2-en-1-ol.
| Compound Name | (Z,1S)-2-(4-methylphenyl)sulfinyl-1-phenylhept-2-en-1-ol |
|---|---|
| PubChem CID | 101210456 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (Z,1S)-2-(4-methylphenyl)sulfinyl-1-phenylhept-2-en-1-ol |
| SMILES | CCCC/C=C(/[C@@H](O)c1ccccc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H24O2S/c1-3-4-6-11-19(20(21)17-9-7-5-8-10-17)23(22)18-14-12-16(2)13-15-18/h5,7-15,20-21H,3-4,6H2,1-2H3/b19-11-/t20-,23?/m0/s1 |
| InChIKey | CSWHEIVYGKUNPE-RVNPEDBGSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|