C24H26O3S — CID 102246508
(Z,1R)-2-(2-methoxynaphthalen-1-yl)sulfinyl-1-phenylhept-2-en-1-ol (PubChem CID 102246508) has the molecular formula C24H26O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is (Z,1R)-2-(2-methoxynaphthalen-1-yl)sulfinyl-1-phenylhept-2-en-1-ol.
| Compound Name | (Z,1R)-2-(2-methoxynaphthalen-1-yl)sulfinyl-1-phenylhept-2-en-1-ol |
|---|---|
| PubChem CID | 102246508 |
| Molecular Formula | C24H26O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (Z,1R)-2-(2-methoxynaphthalen-1-yl)sulfinyl-1-phenylhept-2-en-1-ol |
| SMILES | CCCC/C=C(/[C@H](O)c1ccccc1)S(=O)c1c(OC)ccc2ccccc12 |
| InChI | InChI=1S/C24H26O3S/c1-3-4-6-15-22(23(25)19-12-7-5-8-13-19)28(26)24-20-14-10-9-11-18(20)16-17-21(24)27-2/h5,7-17,23,25H,3-4,6H2,1-2H3/b22-15-/t23-,28?/m1/s1 |
| InChIKey | XJRDQTCHZPLQJH-TWYYQNCSSA-N |
| XLogP | 5.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|