C20H31NO3 — CID 11232880
[(E)-1-hydroxy-1-phenylhept-2-en-2-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 11232880) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [(E)-1-hydroxy-1-phenylhept-2-en-2-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E)-1-hydroxy-1-phenylhept-2-en-2-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11232880 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [(E)-1-hydroxy-1-phenylhept-2-en-2-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CCCC/C=C(/OC(=O)N(C(C)C)C(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C20H31NO3/c1-6-7-9-14-18(19(22)17-12-10-8-11-13-17)24-20(23)21(15(2)3)16(4)5/h8,10-16,19,22H,6-7,9H2,1-5H3/b18-14+ |
| InChIKey | GPJAZEPZOKPXAG-NBVRZTHBSA-N |
| XLogP | 5.05 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|