C21H26O2S — CID 177426448
(2Z)-2-[(4-methylphenyl)sulfinylmethylidene]-1-phenylheptan-1-ol (PubChem CID 177426448) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is (2Z)-2-[(4-methylphenyl)sulfinylmethylidene]-1-phenylheptan-1-ol.
| Compound Name | (2Z)-2-[(4-methylphenyl)sulfinylmethylidene]-1-phenylheptan-1-ol |
|---|---|
| PubChem CID | 177426448 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2Z)-2-[(4-methylphenyl)sulfinylmethylidene]-1-phenylheptan-1-ol |
| SMILES | CCCCC/C(=C/S(=O)c1ccc(C)cc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C21H26O2S/c1-3-4-6-11-19(21(22)18-9-7-5-8-10-18)16-24(23)20-14-12-17(2)13-15-20/h5,7-10,12-16,21-22H,3-4,6,11H2,1-2H3/b19-16- |
| InChIKey | HTKQOXKHPVAIFZ-MNDPQUGUSA-N |
| XLogP | 5.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|