C27H30O3SSe — CID 101184791
(Z)-2-(4-methylphenyl)sulfonyl-1-phenyl-3-phenylselanyloct-2-en-1-ol (PubChem CID 101184791) has the molecular formula C27H30O3SSe and a molecular weight of 513.56 g/mol. Its IUPAC name is (Z)-2-(4-methylphenyl)sulfonyl-1-phenyl-3-phenylselanyloct-2-en-1-ol.
| Compound Name | (Z)-2-(4-methylphenyl)sulfonyl-1-phenyl-3-phenylselanyloct-2-en-1-ol |
|---|---|
| PubChem CID | 101184791 |
| Molecular Formula | C27H30O3SSe |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | (Z)-2-(4-methylphenyl)sulfonyl-1-phenyl-3-phenylselanyloct-2-en-1-ol |
| SMILES | CCCCC/C([Se]c1ccccc1)=C(\C(O)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H30O3SSe/c1-3-4-7-16-25(32-24-14-10-6-11-15-24)27(26(28)22-12-8-5-9-13-22)31(29,30)23-19-17-21(2)18-20-23/h5-6,8-15,17-20,26,28H,3-4,7,16H2,1-2H3/b27-25- |
| InChIKey | XVJSUYWFAPOUTI-RFBIWTDZSA-N |
| XLogP | 5.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|