C35H32O4S2Se — CID 57359431
1-[8-(benzenesulfonyl)-10-phenyl-6-phenylselanyldeca-5,7-dien-9-yn-5-yl]sulfonyl-4-methylbenzene (PubChem CID 57359431) has the molecular formula C35H32O4S2Se and a molecular weight of 659.73 g/mol. Its IUPAC name is 1-[8-(benzenesulfonyl)-10-phenyl-6-phenylselanyldeca-5,7-dien-9-yn-5-yl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[8-(benzenesulfonyl)-10-phenyl-6-phenylselanyldeca-5,7-dien-9-yn-5-yl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 57359431 |
| Molecular Formula | C35H32O4S2Se |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | 1-[8-(benzenesulfonyl)-10-phenyl-6-phenylselanyldeca-5,7-dien-9-yn-5-yl]sulfonyl-4-methylbenzene |
| SMILES | CCCCC(=C(C=C(C#Cc1ccccc1)S(=O)(=O)c1ccccc1)[Se]c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H32O4S2Se/c1-3-4-20-34(41(38,39)31-24-21-28(2)22-25-31)35(42-33-18-12-7-13-19-33)27-32(26-23-29-14-8-5-9-15-29)40(36,37)30-16-10-6-11-17-30/h5-19,21-22,24-25,27H,3-4,20H2,1-2H3 |
| InChIKey | CPJSZZZRCVDFCR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|