C25H28NO3PS — CID 123625875
N-diphenylphosphoryl-1-(4-methylphenyl)sulfonylhexan-1-imine (PubChem CID 123625875) has the molecular formula C25H28NO3PS and a molecular weight of 453.54 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-(4-methylphenyl)sulfonylhexan-1-imine.
| Compound Name | N-diphenylphosphoryl-1-(4-methylphenyl)sulfonylhexan-1-imine |
|---|---|
| PubChem CID | 123625875 |
| Molecular Formula | C25H28NO3PS |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-diphenylphosphoryl-1-(4-methylphenyl)sulfonylhexan-1-imine |
| SMILES | CCCCCC(=NP(=O)(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28NO3PS/c1-3-4-7-16-25(31(28,29)24-19-17-21(2)18-20-24)26-30(27,22-12-8-5-9-13-22)23-14-10-6-11-15-23/h5-6,8-15,17-20H,3-4,7,16H2,1-2H3 |
| InChIKey | RGWIQJUFBGWLPN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|