C26H26O2S — CID 86049180
[1-(benzenesulfonyl)-1-phenylocta-1,2-dien-3-yl]benzene (PubChem CID 86049180) has the molecular formula C26H26O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-1-phenylocta-1,2-dien-3-yl]benzene.
| Compound Name | [1-(benzenesulfonyl)-1-phenylocta-1,2-dien-3-yl]benzene |
|---|---|
| PubChem CID | 86049180 |
| Molecular Formula | C26H26O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [1-(benzenesulfonyl)-1-phenylocta-1,2-dien-3-yl]benzene |
| SMILES | CCCCCC(=C=C(c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26O2S/c1-2-3-7-18-24(22-14-8-4-9-15-22)21-26(23-16-10-5-11-17-23)29(27,28)25-19-12-6-13-20-25/h4-6,8-17,19-20H,2-3,7,18H2,1H3 |
| InChIKey | AHYPUHADFDOXOT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|