C27H20O2S — CID 122210442
[3-(benzenesulfonyl)-1,3-diphenylpropa-1,2-dienyl]benzene (PubChem CID 122210442) has the molecular formula C27H20O2S and a molecular weight of 408.52 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-1,3-diphenylpropa-1,2-dienyl]benzene.
| Compound Name | [3-(benzenesulfonyl)-1,3-diphenylpropa-1,2-dienyl]benzene |
|---|---|
| PubChem CID | 122210442 |
| Molecular Formula | C27H20O2S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [3-(benzenesulfonyl)-1,3-diphenylpropa-1,2-dienyl]benzene |
| SMILES | O=S(=O)(C(=C=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H20O2S/c28-30(29,25-19-11-4-12-20-25)27(24-17-9-3-10-18-24)21-26(22-13-5-1-6-14-22)23-15-7-2-8-16-23/h1-20H |
| InChIKey | SQRUGZBMIVLZPC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |