C10H10O2S — CID 11830311
buta-2,3-dien-2-ylsulfonylbenzene (PubChem CID 11830311) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is buta-2,3-dien-2-ylsulfonylbenzene.
| Compound Name | buta-2,3-dien-2-ylsulfonylbenzene |
|---|---|
| PubChem CID | 11830311 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | buta-2,3-dien-2-ylsulfonylbenzene |
| SMILES | C=C=C(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O2S/c1-3-9(2)13(11,12)10-7-5-4-6-8-10/h4-8H,1H2,2H3 |
| InChIKey | KTSAIPWECWZVOX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |