C13H13ClO3S — CID 102428967
(3Z)-3-(benzenesulfonyl)-4-chloro-5-methylhexa-3,5-dien-2-one (PubChem CID 102428967) has the molecular formula C13H13ClO3S and a molecular weight of 284.76 g/mol. Its IUPAC name is (3Z)-3-(benzenesulfonyl)-4-chloro-5-methylhexa-3,5-dien-2-one.
| Compound Name | (3Z)-3-(benzenesulfonyl)-4-chloro-5-methylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 102428967 |
| Molecular Formula | C13H13ClO3S |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (3Z)-3-(benzenesulfonyl)-4-chloro-5-methylhexa-3,5-dien-2-one |
| SMILES | C=C(C)/C(Cl)=C(\C(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13ClO3S/c1-9(2)12(14)13(10(3)15)18(16,17)11-7-5-4-6-8-11/h4-8H,1H2,2-3H3/b13-12- |
| InChIKey | YCAUNOHCXNRDTI-SEYXRHQNSA-N |
| XLogP | 3.08 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|