C12H14O3S — CID 115042670
1-[1-(benzenesulfonyl)cyclobutyl]ethanone (PubChem CID 115042670) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)cyclobutyl]ethanone.
| Compound Name | 1-[1-(benzenesulfonyl)cyclobutyl]ethanone |
|---|---|
| PubChem CID | 115042670 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-[1-(benzenesulfonyl)cyclobutyl]ethanone |
| SMILES | CC(=O)C1(S(=O)(=O)c2ccccc2)CCC1 |
| InChI | InChI=1S/C12H14O3S/c1-10(13)12(8-5-9-12)16(14,15)11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | IGZKTTWTJBIWAC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |