C17H18O4S2 — CID 102329624
[(1R,2R)-2-(benzenesulfonyl)-1,2-dimethylcyclopropyl]sulfonylbenzene (PubChem CID 102329624) has the molecular formula C17H18O4S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(1R,2R)-2-(benzenesulfonyl)-1,2-dimethylcyclopropyl]sulfonylbenzene.
| Compound Name | [(1R,2R)-2-(benzenesulfonyl)-1,2-dimethylcyclopropyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102329624 |
| Molecular Formula | C17H18O4S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [(1R,2R)-2-(benzenesulfonyl)-1,2-dimethylcyclopropyl]sulfonylbenzene |
| SMILES | C[C@@]1(S(=O)(=O)c2ccccc2)C[C@@]1(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O4S2/c1-16(22(18,19)14-9-5-3-6-10-14)13-17(16,2)23(20,21)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | HLPJEVMHDSEADL-IAGOWNOFSA-N |
| XLogP | 2.86 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |