C11H14O2S — CID 95562608
[(1R)-2,2-dimethylcyclopropyl]sulfonylbenzene (PubChem CID 95562608) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is [(1R)-2,2-dimethylcyclopropyl]sulfonylbenzene.
| Compound Name | [(1R)-2,2-dimethylcyclopropyl]sulfonylbenzene |
|---|---|
| PubChem CID | 95562608 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | [(1R)-2,2-dimethylcyclopropyl]sulfonylbenzene |
| SMILES | CC1(C)C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2S/c1-11(2)8-10(11)14(12,13)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | KKUDEZRMGCRZNF-SNVBAGLBSA-N |
| XLogP | 2.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |