C11H14O4S — CID 99999155
[(2S)-2-(benzenesulfonyl)-1-(hydroxymethyl)cyclopropyl]methanol (PubChem CID 99999155) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is [(2S)-2-(benzenesulfonyl)-1-(hydroxymethyl)cyclopropyl]methanol.
| Compound Name | [(2S)-2-(benzenesulfonyl)-1-(hydroxymethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 99999155 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | [(2S)-2-(benzenesulfonyl)-1-(hydroxymethyl)cyclopropyl]methanol |
| SMILES | O=S(=O)(c1ccccc1)[C@H]1CC1(CO)CO |
| InChI | InChI=1S/C11H14O4S/c12-7-11(8-13)6-10(11)16(14,15)9-4-2-1-3-5-9/h1-5,10,12-13H,6-8H2/t10-/m0/s1 |
| InChIKey | NALIVWGPCYGXKH-JTQLQIEISA-N |
| XLogP | 0.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |