C12H16O4S — CID 99999694
[(2R)-1-(hydroxymethyl)-2-(4-methylphenyl)sulfonylcyclopropyl]methanol (PubChem CID 99999694) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is [(2R)-1-(hydroxymethyl)-2-(4-methylphenyl)sulfonylcyclopropyl]methanol.
| Compound Name | [(2R)-1-(hydroxymethyl)-2-(4-methylphenyl)sulfonylcyclopropyl]methanol |
|---|---|
| PubChem CID | 99999694 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [(2R)-1-(hydroxymethyl)-2-(4-methylphenyl)sulfonylcyclopropyl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CC2(CO)CO)cc1 |
| InChI | InChI=1S/C12H16O4S/c1-9-2-4-10(5-3-9)17(15,16)11-6-12(11,7-13)8-14/h2-5,11,13-14H,6-8H2,1H3/t11-/m1/s1 |
| InChIKey | DHTSKXZBOGDXAD-LLVKDONJSA-N |
| XLogP | 0.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |