C14H19NO3S2 — CID 99999874
trans-(1S,2R)-1-(ethoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide (PubChem CID 99999874) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is trans-(1S,2R)-1-(ethoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide.
| Compound Name | trans-(1S,2R)-1-(ethoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 99999874 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | trans-(1S,2R)-1-(ethoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
| SMILES | CCOC[C@@]1(C(N)=S)C[C@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19NO3S2/c1-3-18-9-14(13(15)19)8-12(14)20(16,17)11-6-4-10(2)5-7-11/h4-7,12H,3,8-9H2,1-2H3,(H2,15,19)/t12-,14+/m1/s1 |
| InChIKey | VENYPYDYIDTIBM-OCCSQVGLSA-N |
| XLogP | 1.85 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|