C13H17NO3S2 — CID 99999847
trans-(1R,2S)-1-(methoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide (PubChem CID 99999847) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is trans-(1R,2S)-1-(methoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide.
| Compound Name | trans-(1R,2S)-1-(methoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 99999847 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | trans-(1R,2S)-1-(methoxymethyl)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
| SMILES | COC[C@]1(C(N)=S)C[C@@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17NO3S2/c1-9-3-5-10(6-4-9)19(15,16)11-7-13(11,8-17-2)12(14)18/h3-6,11H,7-8H2,1-2H3,(H2,14,18)/t11-,13+/m0/s1 |
| InChIKey | VKYBKTUPRKTLQH-WCQYABFASA-N |
| XLogP | 1.46 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|