C11H12N2O2S — CID 102568995
1-amino-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile (PubChem CID 102568995) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-amino-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile.
| Compound Name | 1-amino-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 102568995 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-amino-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)C2CC2(N)C#N)cc1 |
| InChI | InChI=1S/C11H12N2O2S/c1-8-2-4-9(5-3-8)16(14,15)10-6-11(10,13)7-12/h2-5,10H,6,13H2,1H3 |
| InChIKey | WCGFXTUNWKRXHI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |