C12H11NO3S — CID 99999388
cis-(1R,2S)-1-formyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile (PubChem CID 99999388) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is cis-(1R,2S)-1-formyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile.
| Compound Name | cis-(1R,2S)-1-formyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 99999388 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | cis-(1R,2S)-1-formyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C[C@@]2(C#N)C=O)cc1 |
| InChI | InChI=1S/C12H11NO3S/c1-9-2-4-10(5-3-9)17(15,16)11-6-12(11,7-13)8-14/h2-5,8,11H,6H2,1H3/t11-,12+/m0/s1 |
| InChIKey | XYFBLLBNKIJAJS-NWDGAFQWSA-N |
| XLogP | 1.25 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|