C18H14FNO3S — CID 124747386
(1R,2S,3R)-2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile (PubChem CID 124747386) has the molecular formula C18H14FNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is (1R,2S,3R)-2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile.
| Compound Name | (1R,2S,3R)-2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 124747386 |
| Molecular Formula | C18H14FNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (1R,2S,3R)-2-(3-fluorophenyl)-1-formyl-3-(4-methylphenyl)sulfonylcyclopropane-1-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2[C@@H](c3cccc(F)c3)[C@@]2(C#N)C=O)cc1 |
| InChI | InChI=1S/C18H14FNO3S/c1-12-5-7-15(8-6-12)24(22,23)17-16(18(17,10-20)11-21)13-3-2-4-14(19)9-13/h2-9,11,16-17H,1H3/t16-,17-,18-/m1/s1 |
| InChIKey | RNWORIGFUVXEMI-KZNAEPCWSA-N |
| XLogP | 2.78 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|